Introduction:Basic information about CAS 50766-86-4|3-Nitrobutyrophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitrobutyrophenone |
|---|
| CAS Number | 50766-86-4 | Molecular Weight | 193.19900 |
|---|
| Density | 1.165 g/cm3 | Boiling Point | 271.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(3-nitrophenyl)butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.165 g/cm3 |
|---|
| Boiling Point | 271.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO3 |
|---|
| Molecular Weight | 193.19900 |
|---|
| Exact Mass | 193.07400 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 3.10080 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | HJLRYDBRORTQIU-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(=O)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-Butanone,1-(3-nitrophenyl) |
| 1-(3-Nitro-phenyl)-butan-1-on |
| <3-Nitro-phenyl>-propyl-keton |
| 1-(3-Nitro-phenyl)-butan-1-one |
| 3'-nitropropiophenone |
| m-Nitrobutyrophenone |
| MFCD00024523 |
| 1-(3-nitrophenyl)-1-butanone |
| 3-Nitro-butyrophenon |
| 3'-NITROBUTYROPHENONE |
| Propyl-(3-nitro-phenyl)-keton |