Introduction:Basic information about CAS 2454-70-8|N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine,hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine,hydrochloride |
|---|
| CAS Number | 2454-70-8 | Molecular Weight | 282.80900 |
|---|
| Density | 1.061g/cm3 | Boiling Point | 396.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H23ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.4ºC |
|---|
Names
| Name | N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine,hydrochloride |
|---|
Chemical & Physical Properties
| Density | 1.061g/cm3 |
|---|
| Boiling Point | 396.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H23ClN2O |
|---|
| Molecular Weight | 282.80900 |
|---|
| Flash Point | 193.4ºC |
|---|
| Exact Mass | 282.15000 |
|---|
| PSA | 28.26000 |
|---|
| LogP | 3.86280 |
|---|
| Vapour Pressure | 1.74E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | OUUICFYPNJVLSZ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCc1c[nH]c2ccc(OC)cc12.Cl |
|---|