Introduction：Basic information about CAS 53581-38-7|9-Phenanthrenecarboxylicacid, 6-bromo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-Phenanthrenecarboxylicacid, 6-bromo- |
|---|
| CAS Number | 53581-38-7 | Molecular Weight | 301.13500 |
|---|
| Density | 1.615g/cm3 | Boiling Point | 482.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H9BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.8ºC |
|---|
Names
| Name | 6-bromophenanthrene-9-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.615g/cm3 |
|---|
| Boiling Point | 482.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H9BrO2 |
|---|
| Molecular Weight | 301.13500 |
|---|
| Flash Point | 245.8ºC |
|---|
| Exact Mass | 299.97900 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.45370 |
|---|
| Index of Refraction | 1.758 |
|---|
| InChIKey | UEWHMHUEUVHQQH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2ccccc2c2cc(Br)ccc12 |
|---|
Synonyms
| 3-Brom-phenanthren-10-carbonsaeure |
| 6-bromo-phenanthrene-9-carboxylic acid |
| 6-Bromo-9-phenanthrenecarboxylic acid |
| 6-Bromo-9-phenanthroic acid |
| 6-Brom-phenanthren-9-carbonsaeure |
