Introduction：Basic information about CAS 56409-75-7|Benzenepropanoic acid, b-oxo-a-(phenylmethyl)-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid, b-oxo-a-(phenylmethyl)-, ethyl ester |
|---|
| CAS Number | 56409-75-7 | Molecular Weight | 282.33400 |
|---|
| Density | 1.122g/cm3 | Boiling Point | 359.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.8ºC |
|---|
Names
| Name | ethyl 2-benzyl-3-oxo-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.122g/cm3 |
|---|
| Boiling Point | 359.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O3 |
|---|
| Molecular Weight | 282.33400 |
|---|
| Flash Point | 154.8ºC |
|---|
| Exact Mass | 282.12600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.29130 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | KSTSKHKQRFGSJH-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)c1ccccc1 |
|---|
Synonyms
| 2-benzyl-3-oxo-3-phenylpropionic acid ethyl ester |
| EINECS 260-162-5 |
| ethyl benzylbenzoylacetate |
| Ethyl 2-benzylbenzoylacetate |
| ethyl 2-benzoylhydrocinnamate |
| 2-benzyl benzoylacetate d'ethyle |
