Introduction：Basic information about CAS 24055-46-7|Naphthalene,2,3-dimethyl-1-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naphthalene,2,3-dimethyl-1-nitro- |
|---|
| CAS Number | 24055-46-7 | Molecular Weight | 201.22100 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 345.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.9ºC |
|---|
Names
| Name | 2,3-dimethyl-1-nitronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 345.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO2 |
|---|
| Molecular Weight | 201.22100 |
|---|
| Flash Point | 163.9ºC |
|---|
| Exact Mass | 201.07900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.88800 |
|---|
| Vapour Pressure | 0.000124mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | HAJFJHPDGUZFGH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2ccccc2c([N+](=O)[O-])c1C |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1-nitro-2,3-dimethylnaphthalene |
| Naphthalene,2,3-dimethyl-1-nitro |
| 1-Nitro-2,3-dimethylnaphthalin |
| 2,3-dimethyl-1-nitro-naphthalene |
| 2,3-Dimethyl-1-nitro-naphthalin |
