Introduction：Basic information about CAS 20592-42-1|Estra-1,3,5(10),16-tetraene-3,17-diol diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Estra-1,3,5(10),16-tetraene-3,17-diol diacetate |
|---|
| CAS Number | 20592-42-1 | Molecular Weight | 354.43900 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 490.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H26O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.3ºC |
|---|
Names
| Name | (3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 490.8ºC at 760 mmHg |
|---|
| Molecular Formula | C22H26O4 |
|---|
| Molecular Weight | 354.43900 |
|---|
| Flash Point | 245.3ºC |
|---|
| Exact Mass | 354.18300 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.52490 |
|---|
| Vapour Pressure | 8.84E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | KPJNGUPMJAHAND-JBPLPALLSA-N |
|---|
| SMILES | CC(=O)OC1=CCC2C3CCc4cc(OC(C)=O)ccc4C3CCC12C |
|---|
Synonyms
| Estra-1,5(10),16-tetraene-3,17-diol,diacetate |
| 3,17-Diacetoxy-oestra-1,3,5(10),16-tetraen |
| Estrone enol diacetate |
| estrone 3-acetate (17-enol acetate) |
| Estra-1,3,5(10),16-tetraene-3,17-diol diacetate |
| estra-1,3,5(10),16-tetraene-3,17-diyl diacetate |
| 3,17-diacetoxy-estra-1,3,5(10),16-tetraene |
