Introduction：Basic information about CAS 10300-22-8|Adenosine, 3'-O-methyl-(7CI,8CI,9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Adenosine, 3'-O-methyl-(7CI,8CI,9CI) |
|---|
| CAS Number | 10300-22-8 | Molecular Weight | 281.26800 |
|---|
| Density | 1.84g/cm3 | Boiling Point | 623.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H15N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331ºC |
|---|
Names
| Name | 3'-O-Methyladenosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.84g/cm3 |
|---|
| Boiling Point | 623.8ºC at 760mmHg |
|---|
| Molecular Formula | C11H15N5O4 |
|---|
| Molecular Weight | 281.26800 |
|---|
| Flash Point | 331ºC |
|---|
| Exact Mass | 281.11200 |
|---|
| PSA | 128.54000 |
|---|
| Vapour Pressure | 2.02E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.794 |
|---|
| InChIKey | RYAFZRROCNNRFK-IOSLPCCCSA-N |
|---|
| SMILES | COC1C(CO)OC(n2cnc3c(N)ncnc32)C1O |
|---|
Synonyms
| 3'-O-Methyl-adenosin |
| 3'-O-methyl-3'-deoxyadenosine |
| O3'-methyladenosine |
| 3'-OMe-A |
| 3'-O-Methyl-D-adenosine |
