Introduction：Basic information about CAS 4634-13-3|Methyl 6-phenylpyridin-3-ylcarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 6-phenylpyridin-3-ylcarboxylate |
|---|
| CAS Number | 4634-13-3 | Molecular Weight | 213.23200 |
|---|
| Density | 1.147g/cm3 | Boiling Point | 336.2ºC at 760mmHg |
|---|
| Molecular Formula | C13H11NO2 | Melting Point | >1100ºC(dec.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl 6-phenylpyridine-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.147g/cm3 |
|---|
| Boiling Point | 336.2ºC at 760mmHg |
|---|
| Melting Point | >1100ºC(dec.) |
|---|
| Molecular Formula | C13H11NO2 |
|---|
| Molecular Weight | 213.23200 |
|---|
| Exact Mass | 213.07900 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 2.53520 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | DXHZSBAEWGPUKI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2ccccc2)nc1 |
|---|
Synonyms
| Methyl 6-phenylnicotinate |
| 6-phenylpyridine-3-carboxylic acid methyl ester |
| 6-phenyl-nicotinic acid methyl ester |
| methyl 6-phenyl-3-pyridinecarboxylate |
| methyl 2-phenyl-5-pyridinecarboxylate |
