Introduction：Basic information about CAS 1470-38-8|1H-Indene-1,3(2H)-dione,2-(3,4-dimethoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indene-1,3(2H)-dione,2-(3,4-dimethoxyphenyl)- |
|---|
| CAS Number | 1470-38-8 | Molecular Weight | 282.29100 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 458.9ºC at 760mmHg |
|---|
| Molecular Formula | C17H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.1ºC |
|---|
Names
| Name | 2-(3,4-dimethoxyphenyl)indene-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 458.9ºC at 760mmHg |
|---|
| Molecular Formula | C17H14O4 |
|---|
| Molecular Weight | 282.29100 |
|---|
| Flash Point | 205.1ºC |
|---|
| Exact Mass | 282.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.86660 |
|---|
| Vapour Pressure | 1.32E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | ABMVPHQMDUVUSM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C2C(=O)c3ccccc3C2=O)cc1OC |
|---|
Synonyms
| 2-(3,4-Dimethoxy-phenyl)-indan-1,3-dion |
| HMS2592F08 |
| 2-Veratrylindan-1,3-dion |
| 2-(3,4-Dimethoxyphenyl)-1,3-indandion |
| 2-(3,4-dimethoxyphenyl)indan-1,3-dione |
| HMS1607O19 |
| 2-(3,4-Dimethoxy-benzyl)-indandion-(1,3) |
