Introduction:Basic information about CAS 327-95-7|4-Fluoroisophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoroisophthalic acid |
|---|
| CAS Number | 327-95-7 | Molecular Weight | 184.12100 |
|---|
| Density | 1.551g/cm3 | Boiling Point | 403.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5FO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.8ºC |
|---|
Names
| Name | 4-fluorobenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.551g/cm3 |
|---|
| Boiling Point | 403.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5FO4 |
|---|
| Molecular Weight | 184.12100 |
|---|
| Flash Point | 197.8ºC |
|---|
| Exact Mass | 184.01700 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.22210 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | OPWLKVOLSUNGEI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(F)c(C(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Fluor-isophthalsaeure |
| 4-fluoro-isophthalic acid |
| 4-fluorobenzene-1,3-dioic acid |
| 4-Fluor-isophtalsaeure |