Introduction:Basic information about CAS 946664-06-8|4-(4-Chlorophenoxy)-3-fluoroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-Chlorophenoxy)-3-fluoroaniline |
|---|
| CAS Number | 946664-06-8 | Molecular Weight | 237.65700 |
|---|
| Density | 1.331g/cm3 | Boiling Point | 331.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClFNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.5ºC |
|---|
Names
| Name | 4-(4-Chlorophenoxy)-3-fluoroaniline |
|---|
Chemical & Physical Properties
| Density | 1.331g/cm3 |
|---|
| Boiling Point | 331.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClFNO |
|---|
| Molecular Weight | 237.65700 |
|---|
| Flash Point | 154.5ºC |
|---|
| Exact Mass | 237.03600 |
|---|
| PSA | 35.25000 |
|---|
| LogP | 4.43480 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | QUDNGESABWWZII-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Oc2ccc(Cl)cc2)c(F)c1 |
|---|