Introduction:Basic information about CAS 1092288-84-0|5-(2,5-Dimethoxyphenyl)cyclohexane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2,5-Dimethoxyphenyl)cyclohexane-1,3-dione |
|---|
| CAS Number | 1092288-84-0 | Molecular Weight | 248.27400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(2,5-Dimethoxyphenyl)cyclohexane-1,3-dione |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H16O4 |
|---|
| Molecular Weight | 248.27400 |
|---|
| Exact Mass | 248.10500 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.10950 |
|---|
| InChIKey | IORAMGISNOTYIW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(OC)c(C2CC(=O)CC(=O)C2)c1 |
|---|
Safety Information
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|