Introduction:Basic information about CAS 155396-16-0|4-Oxoadamantane-1-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Oxoadamantane-1-carboxamide |
|---|
| CAS Number | 155396-16-0 | Molecular Weight | 193.24200 |
|---|
| Density | 1.295g/cm3 | Boiling Point | 406.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.7ºC |
|---|
Names
| Name | 4-Oxoadamantane-1-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.295g/cm3 |
|---|
| Boiling Point | 406.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15NO2 |
|---|
| Molecular Weight | 193.24200 |
|---|
| Flash Point | 199.7ºC |
|---|
| Exact Mass | 193.11000 |
|---|
| PSA | 60.16000 |
|---|
| LogP | 1.56740 |
|---|
| Vapour Pressure | 8.09E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | WBKQGUVLWVPHQU-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
|---|