Introduction:Basic information about CAS 16808-41-6|2-(Adamantan-1-yl)isoindoline-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Adamantan-1-yl)isoindoline-1,3-dione |
|---|
| CAS Number | 16808-41-6 | Molecular Weight | 281.34900 |
|---|
| Density | 1.336g/cm3 | Boiling Point | 414.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H19NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.5ºC |
|---|
Names
| Name | 2-(1-adamantyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.336g/cm3 |
|---|
| Boiling Point | 414.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H19NO2 |
|---|
| Molecular Weight | 281.34900 |
|---|
| Flash Point | 180.5ºC |
|---|
| Exact Mass | 281.14200 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 3.18930 |
|---|
| Vapour Pressure | 4.5E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | NNPFLBWYAZEFOL-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1C12CC3CC(CC(C3)C1)C2 |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(adamant-1-yl)isoindole-1,3-dione |
| N-adamantan-1-yl-phthalimide |
| 1-adamantylphthalimide |
| N-1-Adamantyl-phthalimid |
| N-(1-adamantyl)phthalimide |
| N-(adamant-1-yl)phthalimide |