Introduction：Basic information about CAS 7200-46-6|5-Phenyl-4H-[1,2,4]triazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Phenyl-4H-[1,2,4]triazole-3-carboxylic acid |
|---|
| CAS Number | 7200-46-6 | Molecular Weight | 189.17100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H7N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-Phenyl-1H-1,2,4-triazole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H7N3O2 |
|---|
| Molecular Weight | 189.17100 |
|---|
| Exact Mass | 189.05400 |
|---|
| PSA | 78.87000 |
|---|
| LogP | 1.16990 |
|---|
| InChIKey | GFGNJPGMLRGJBI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1nc(-c2ccccc2)n[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2,4-Thiadiazol-3(2H)-one,5-phenyl |
| 5-Phenyl-1,2,4-triazol-3-carboxylsaeure |
| 3-Phenyl-1,2,4-triazol-5-carbonsaeure |
| 3-Hydroxy-5-phenyl-1,2,4-thiodiazol |
| 5-phenyl-1,2,4-thiadiazole-3-ole |
| 3-hydroxy-5-phenyl-1,2,4-thiadiazole |
| 5-phenyl-2H-[1,2,4]triazole-3-carboxylic acid |
| 5-Phenyl-3-hydroxy-1,2,4-thiadiazol |
| 3-Hydroxy-5-phenyl-1,2,4-thiadiazol |
| 5-phenyl-[1,2,4]thiadiazol-3-ol |
| 3-Phenyl-s-triazol-5-carbonsaeure |
