Introduction:Basic information about CAS 320-37-6|4-Nitro-2-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitro-2-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 320-37-6 | Molecular Weight | 235.117 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 321.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4F3NO4 | Melting Point | 138-142ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 148.2±27.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Nitro-2-(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 321.4±42.0 °C at 760 mmHg |
|---|
| Melting Point | 138-142ºC(lit.) |
|---|
| Molecular Formula | C8H4F3NO4 |
|---|
| Molecular Weight | 235.117 |
|---|
| Flash Point | 148.2±27.9 °C |
|---|
| Exact Mass | 235.009247 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.96 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | BPCKZQCTLCTDST-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C(F)(F)F |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3.0 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD04039246 |
| 4-Nitro-2-(trifluoromethyl)benzoic acid |
| 4-nitro-2-trifluoromethyl-benzoic acid |
| 4-Nitro-2-trifluormethyl-benzoesaeure |
| RARECHEM AL BO 1444 |
| 2-Carboxy-5-nitrobenzotrifluoride |
| Benzoic acid, 4-nitro-2-(trifluoromethyl)- |