Introduction:Basic information about CAS 72086-72-7|Boc-Glu-OMe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Glu-OMe |
|---|
| CAS Number | 72086-72-7 | Molecular Weight | 261.272 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 428.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H19NO6 | Melting Point | 119-123ºC |
|---|
| MSDS | / | Flash Point | 212.9±27.3 °C |
|---|
Names
| Name | (4S)-5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 428.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 119-123ºC |
|---|
| Molecular Formula | C11H19NO6 |
|---|
| Molecular Weight | 261.272 |
|---|
| Flash Point | 212.9±27.3 °C |
|---|
| Exact Mass | 261.121246 |
|---|
| PSA | 101.93000 |
|---|
| LogP | 1.59 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.470 |
|---|
| InChIKey | ZAYAFKXUQMTLPL-ZETCQYMHSA-N |
|---|
| SMILES | COC(=O)C(CCC(=O)O)NC(=O)OC(C)(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Boc-Glu(OMe)-OH |
| N-Boc-L-glutamic acid 5-methyl ester |
| (L)-Boc-Glu-OCH3 |
| (S)-4-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid |
| (2S)-2-[(tert-Butoxycarbonyl)amino]-5-methoxy-5-oxopentanoic acid (non-preferred name) |
| Boc-L-glutamic acid 1-methyl ester |
| 1X1&1&OVMYVQ2VO1 &&L or S Form |
| N-Boc-glutamic acid 4-methyl ester |
| L-BocNH-Glu-OMe |
| Boc-L-glutamic acid |A-methyl ester |
| Boc-L-glutamic acid 5-methyl ester |
| (2S)-5-Methoxy-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid |
| L-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-methyl ester |
| BOC-GLU-OME |