Introduction:Basic information about CAS 106391-87-1|N-Boc-D-Valinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-D-Valinol |
|---|
| CAS Number | 106391-87-1 | Molecular Weight | 203.279 |
|---|
| Density | 0.995 | Boiling Point | 218 ºC |
|---|
| Molecular Formula | C10H21NO3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 137.1±23.2 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | Boc-D-Valinol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.995 |
|---|
| Boiling Point | 218 ºC |
|---|
| Molecular Formula | C10H21NO3 |
|---|
| Molecular Weight | 203.279 |
|---|
| Flash Point | 137.1±23.2 °C |
|---|
| Exact Mass | 203.152145 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 1.71 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.451 |
|---|
| InChIKey | OOQRRYDVICNJGC-QMMMGPOBSA-N |
|---|
| SMILES | CC(C)C(CO)NC(=O)OC(C)(C)C |
|---|
| Storage condition | 2~8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Boc-D-valinol |
| MFCD00235960 |
| N-BOC-D-Valinol |
| (R)-tert-Butyl (1-hydroxy-3-methylbutan-2-yl)carbamate |
| Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2-methylpropyl]-, 1,1-dimethylethyl ester |
| N-t-BOC-D-Valinol |
| tert-Butyl [(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| tert-butyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| 2-Methyl-2-propanyl [(2R)-1-hydroxy-3-methyl-2-butanyl]carbamate |
| Boc-D-Val-ol |