Introduction：Basic information about CAS 669713-95-5|4-N-Boc-amino-3-methoxyphenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-N-Boc-amino-3-methoxyphenylboronic acid |
|---|
| CAS Number | 669713-95-5 | Molecular Weight | 267.08600 |
|---|
| Density | 1.2g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H18BNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Molecular Formula | C12H18BNO5 |
|---|
| Molecular Weight | 267.08600 |
|---|
| Exact Mass | 267.12800 |
|---|
| PSA | 88.02000 |
|---|
| LogP | 0.79500 |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | PAWJDEHKEKNFAN-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(B(O)O)ccc1NC(=O)OC(C)(C)C |
|---|
Synonyms
| 4-N-Boc-amino-3-methoxy-benzeneboronic acid |
| 4-n-boc-amino-3-methoxy-phenylboronic acid |
| 4-(tert-butoxycarbonylamino)-3-methoxyphenylboronic acid |
| 4-(tert-butoxycarbonyl)-3-methoxyphenylboronic acid |
