Introduction：Basic information about CAS 748812-53-5|1-pentanoylamino-cyclopentanecarboxylic acid [2'-(1h-tetrazol-5-yl)-biphe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-pentanoylamino-cyclopentanecarboxylic acid [2'-(1h-tetrazol-5-yl)-biphenyl-4-ylmethyl]-amide |
|---|
| CAS Number | 748812-53-5 | Molecular Weight | 446.545 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H30N6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(pentanoylamino)-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]cyclopentane-1-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C25H30N6O2 |
|---|
| Molecular Weight | 446.545 |
|---|
| Exact Mass | 446.243011 |
|---|
| PSA | 119.64000 |
|---|
| LogP | 3.11 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | PAKGYCNZUGIDHV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(=O)NC1(C(=O)NCc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)CCCC1 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Cyclopentanecarboxamide, 1-[(1-oxopentyl)amino]-N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]- |
| 1-(Pentanoylamino)-N-{[2'-(1H-tetrazol-5-yl)-4-biphenylyl]methyl}cyclopentanecarboxamide |
| sc1287 |
| irbesartan related compound a |
| 1-pentanoylamino-cyclopentanecarboxylic acid [2'-(1h-tetrazol-5-yl)-biphenyl-4-ylmethyl]-amide |
| Irbesartan Impurity 1 |
