Introduction：Basic information about CAS 102735-88-6|5-Fluoro-2-methyl-1,3-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Fluoro-2-methyl-1,3-dinitrobenzene |
|---|
| CAS Number | 102735-88-6 | Molecular Weight | 200.124 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 282.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5FN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.7±25.9 °C |
|---|
Names
| Name | 5-Fluoro-2-methyl-1,3-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 282.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5FN2O4 |
|---|
| Molecular Weight | 200.124 |
|---|
| Flash Point | 124.7±25.9 °C |
|---|
| Exact Mass | 200.023331 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 1.93 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | GLIDVOGSKCTART-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c([N+](=O)[O-])cc(F)cc1[N+](=O)[O-] |
|---|
Synonyms
| 4-Fluoro-2,6-dinitrotoluene |
| 5-Fluoro-2-methyl-1,3-dinitrobenzene |
| 2,6-dinitro-4-fluorotoluene |
| Benzene, 5-fluoro-2-methyl-1,3-dinitro- |
| Benzene,5-fluoro-2-methyl-1,3-dinitro |
