Introduction:Basic information about CAS 103204-69-9|4-Acetamido-2-Methylbenzoic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Acetamido-2-Methylbenzoic Acid |
|---|
| CAS Number | 103204-69-9 | Molecular Weight | 193.19900 |
|---|
| Density | 1.276g/cm3 | Boiling Point | 421.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H11NO3 | Melting Point | 237-242ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 208.9ºC |
|---|
Names
| Name | 4-acetamido-2-methylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.276g/cm3 |
|---|
| Boiling Point | 421.9ºC at 760mmHg |
|---|
| Melting Point | 237-242ºC(lit.) |
|---|
| Molecular Formula | C10H11NO3 |
|---|
| Molecular Weight | 193.19900 |
|---|
| Flash Point | 208.9ºC |
|---|
| Exact Mass | 193.07400 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.72460 |
|---|
| Vapour Pressure | 7.18E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | AQPDTYYKDYMCTH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(C(=O)O)c(C)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Acetamino-2-methyl-benzoesaeure |
| 4-(acetylamino)-2-methylbenzoic acid |
| 4-Acetylamino-2-methyl-benzoesaeure |
| 4-Acetamino-o-toluylsaeure |
| 4-acetamido-2-methyl-benzoic acid |
| N-acetyl-4-amino-2-methyl-benzoic acid |
| MFCD02258874 |