Introduction:Basic information about CAS 14450-05-6|2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate |
|---|
| CAS Number | 14450-05-6 | Molecular Weight | 697.03700 |
|---|
| Density | 0.969g/cm3 | Boiling Point | 699.1ºC at 760mmHg |
|---|
| Molecular Formula | C41H76O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.6ºC |
|---|
Names
| Name | [3-nonanoyloxy-2,2-bis(nonanoyloxymethyl)propyl] nonanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.969g/cm3 |
|---|
| Boiling Point | 699.1ºC at 760mmHg |
|---|
| Molecular Formula | C41H76O8 |
|---|
| Molecular Weight | 697.03700 |
|---|
| Flash Point | 273.6ºC |
|---|
| Exact Mass | 696.55400 |
|---|
| PSA | 105.20000 |
|---|
| LogP | 11.14800 |
|---|
| Vapour Pressure | 2.16E-19mmHg at 25°C |
|---|
| Index of Refraction | 1.465 |
|---|
| InChIKey | IBKKMFMBXQARGV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC |
|---|
Safety Information
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| tetra-O-nonanoyl-pentaerythritol |
| 2,2-dimiristoyloxymethyltrimethylene dimiristate |
| tetra-O-myristoyl-pentaerythritol |
| Pentaerythrityl tetramyristate |
| Tetradecanoic acid,2,2-bis(((1-oxotetradecyl)oxy)methyl)-1,3-propanediyl ester |
| pentaerythritol tetra-pelargonate |
| Pentaerythritol tetranonanoate |
| 2,2-bis[[(1-oxononyl)oxy]methyl]propane-1,3-diyl dinonan-1-oate |
| pentaerythrityl tetrapelargonate |
| Tetra-O-nonanoyl-pentaerythrit |
| Myristic acid,tetraester with pentaerythritol |
| Pentaerythritol,tetramyristate |
| Tetra-O-myristoyl-pentaerythrit |