Introduction:Basic information about CAS 14450-07-8|bis[(Z)-octadec-9-enyl] hydrogen phosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis[(Z)-octadec-9-enyl] hydrogen phosphate |
|---|
| CAS Number | 14450-07-8 | Molecular Weight | 598.92000 |
|---|
| Density | 0.929g/cm3 | Boiling Point | 651.4ºC at 760mmHg |
|---|
| Molecular Formula | C36H71O4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 347.7ºC |
|---|
Names
| Name | bis[(Z)-octadec-9-enyl] hydrogen phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.929g/cm3 |
|---|
| Boiling Point | 651.4ºC at 760mmHg |
|---|
| Molecular Formula | C36H71O4P |
|---|
| Molecular Weight | 598.92000 |
|---|
| Flash Point | 347.7ºC |
|---|
| Exact Mass | 598.50900 |
|---|
| PSA | 65.57000 |
|---|
| LogP | 13.19500 |
|---|
| Vapour Pressure | 1.2E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.473 |
|---|
| InChIKey | WFFZELZOEWLYNK-CLFAGFIQSA-N |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCCOP(=O)(O)OCCCCCCCCC=CCCCCCCCC |
|---|
Safety Information
Customs
| HS Code | 2919900090 |
|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| Dioleyl hydrogen phosphate |
| Dioleoyl phosphate |
| Dioleylphosphat |
| 9-Octadecen-1-ol,hydrogen phosphate,(9Z,9'Z) |
| dioleyl phosphate |
| phosphoric acid di-octadec-9c-enyl ester |
| 9-Octadecen-1-ol,hydrogen phosphate,(Z,Z) |
| EINECS 238-431-3 |
| 9-Octadecen-1-ol,1,1'-(hydrogen phosphate),(9Z,9'Z) |