Introduction：Basic information about CAS 22025-44-1|4-(4-ethoxyanilino)-3-nitrobenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-ethoxyanilino)-3-nitrobenzenesulfonamide |
|---|
| CAS Number | 22025-44-1 | Molecular Weight | 337.35100 |
|---|
| Density | 1.424g/cm3 | Boiling Point | 531.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H15N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.5ºC |
|---|
Names
| Name | 4-(4-ethoxyanilino)-3-nitrobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.424g/cm3 |
|---|
| Boiling Point | 531.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H15N3O5S |
|---|
| Molecular Weight | 337.35100 |
|---|
| Flash Point | 275.5ºC |
|---|
| Exact Mass | 337.07300 |
|---|
| PSA | 135.62000 |
|---|
| LogP | 4.76180 |
|---|
| Vapour Pressure | 2.15E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | VNBLMPPORJRWNG-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-[(4-ethoxyphenyl)amino]-3-nitrobenzenesulfonamide |
| N4-(p-ethoxyphenyl)-3-nitrosulfanilamide |
| 3-nitro-4-p-phenetidino-benzenesulfonic acid amide |
| 3-Nitro-4-p-phenetidino-benzolsulfonsaeure-amid |
| 3-Nitro-4-p-phenentidino-benzolsulfonamid-(1) |
| Benzenesulfonamide,4-((4-ethoxyphenyl)amino)-3-nitro |
| EINECS 244-727-3 |
| 4-<4-Aethoxy-anilino>-3-nitro-benzol-sulfonsaeure-(1)-amid |
