Introduction:Basic information about CAS 285984-54-5|N-(4-aminonaphthalen-1-yl)pyridine-4-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-aminonaphthalen-1-yl)pyridine-4-carboxamide |
|---|
| CAS Number | 285984-54-5 | Molecular Weight | 263.29400 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 421ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.4ºC |
|---|
Names
| Name | N-(4-aminonaphthalen-1-yl)pyridine-4-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 421ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13N3O |
|---|
| Molecular Weight | 263.29400 |
|---|
| Flash Point | 208.4ºC |
|---|
| Exact Mass | 263.10600 |
|---|
| PSA | 71.50000 |
|---|
| LogP | 4.03450 |
|---|
| Vapour Pressure | 2.7E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.754 |
|---|
| InChIKey | MYYRXFKZZADNBL-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(NC(=O)c2ccncc2)c2ccccc12 |
|---|