Introduction：Basic information about CAS 69145-58-0|2,4-dichloro-3-methylbenzenesulfonyl chloride(SALTDATA: FREE), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-dichloro-3-methylbenzenesulfonyl chloride(SALTDATA: FREE) |
|---|
| CAS Number | 69145-58-0 | Molecular Weight | 259.53700 |
|---|
| Density | 1.56 g/cm3 | Boiling Point | 331ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154ºC |
|---|
Names
| Name | 2,4-Dichloro-3-methylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56 g/cm3 |
|---|
| Boiling Point | 331ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl3O2S |
|---|
| Molecular Weight | 259.53700 |
|---|
| Flash Point | 154ºC |
|---|
| Exact Mass | 257.90800 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.31010 |
|---|
| InChIKey | XMKNKDQXFBQJDP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,6-Dichlor-toluol-3-sulfonylchlorid |
| 2,4-dichloro-3-methylbenzenesulphonyl chloride |
| 2,6-dichloro-toluene-3-sulfonyl chloride |
