Introduction:Basic information about CAS 81294-16-8|3,2':5',3''-terthiophene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,2':5',3''-terthiophene |
|---|
| CAS Number | 81294-16-8 | Molecular Weight | 248.38700 |
|---|
| Density | 1.318g/cm3 | Boiling Point | 315.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8S3 | Melting Point | 175-181ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 106.8ºC |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | 3,2':5',3''-terthiophene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.318g/cm3 |
|---|
| Boiling Point | 315.6ºC at 760 mmHg |
|---|
| Melting Point | 175-181ºC(lit.) |
|---|
| Molecular Formula | C12H8S3 |
|---|
| Molecular Weight | 248.38700 |
|---|
| Flash Point | 106.8ºC |
|---|
| Exact Mass | 247.97900 |
|---|
| PSA | 84.72000 |
|---|
| LogP | 5.20510 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | OQKJYJOKTGKIRJ-UHFFFAOYSA-N |
|---|
| SMILES | c1cc(-c2ccc(-c3ccsc3)s2)cs1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301 |
|---|
| Precautionary Statements | P301 + P310 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
Synonyms
| 2,5-di(thiophen-3-yl)thiophene |
| 2,2':5',3''-terthiophene |
| 2,5-bis(3-thienyl)thiophene |
| 3,2':5',3''-Terthiophene |