Introduction:Basic information about CAS 52938-96-2|5-(4-Bromophenyl)-2-furoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Bromophenyl)-2-furoic acid |
|---|
| CAS Number | 52938-96-2 | Molecular Weight | 267.07500 |
|---|
| Density | 1.606g/cm3 | Boiling Point | 415.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrO3 | Melting Point | 205-209ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 204.9ºC |
|---|
Names
| Name | 5-(4-bromophenyl)furan-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.606g/cm3 |
|---|
| Boiling Point | 415.1ºC at 760 mmHg |
|---|
| Melting Point | 205-209ºC(lit.) |
|---|
| Molecular Formula | C11H7BrO3 |
|---|
| Molecular Weight | 267.07500 |
|---|
| Flash Point | 204.9ºC |
|---|
| Exact Mass | 265.95800 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 3.40730 |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | MYPDSPQSFHXXTF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc(Br)cc2)o1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 5-(4-bromophenyl)-2-furoic acid |
| 5-<4-Brom-phenyl>-furan-2-carbonsaeure |
| MFCD00194276 |
| 5-(4'-Bromophenyl)-2-furan-carbonsaeure |
| 5-p-bromophenyl-furan-2-carboxylic acid |
| 5-(4-bromo-phenyl)-furan-2-carboxylic acid |
| 5-<p-Brom-phenyl>-pyromucinsaeure |