Introduction:Basic information about CAS 179688-29-0|6,7-Bis(2-methoxyethoxy)-4(1H)-quinazolinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,7-Bis(2-methoxyethoxy)-4(1H)-quinazolinone |
|---|
| CAS Number | 179688-29-0 | Molecular Weight | 294.303 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 502.0±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O5 | Melting Point | 185-189ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 257.4±30.1 °C |
|---|
Names
| Name | 6,7-bis(2-methoxyethoxy)-1H-quinazolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 502.0±50.0 °C at 760 mmHg |
|---|
| Melting Point | 185-189ºC |
|---|
| Molecular Formula | C14H18N2O5 |
|---|
| Molecular Weight | 294.303 |
|---|
| Flash Point | 257.4±30.1 °C |
|---|
| Exact Mass | 294.121582 |
|---|
| PSA | 82.67000 |
|---|
| LogP | -0.16 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | PMQWTUWLIGJTQD-UHFFFAOYSA-N |
|---|
| SMILES | COCCOc1cc2nc[nH]c(=O)c2cc1OCCOC |
|---|
| Storage condition | -20°C Freezer |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6,7-Bis(2-methoxyethoxy)quinazolin-4(1H)-one |
| 6,7-Bis(2-methoxyethoxy)-3,4-dihydroquinazolin-4-one |
| 6,7-Bis(2-methoxyethoxy)quinazolin-4(3H)-one |
| 4(3H)-Quinazolinone, 6,7-bis(2-methoxyethoxy)- |
| T66 BVN EMJ HO2O1 IO2O1 |
| 6,7-Bis(2-methoxyethoxy)-3H-quinazolin-4-one |
| 6,7-bis-(2-Methoxyethoxy)-quinazolin-4(3h)-one |
| 6,7-bis(2-methoxyethoxy)quinazoline-4(3H)-one |
| T66 BN DNJ EQ HO2O1 IO2O1 |
| MFCD08458402 |
| 4(1H)-Quinazolinone, 6,7-bis(2-methoxyethoxy)- |
| 6,7-Bis(2-methoxyethoxy)-4-quinazolinol |
| 6,7-di-(2-methoxyethoxy)-3,4-dihydroquinazolin-4-one |
| 6,7-Bis(2-methoxyethoxy)-4(3H)-quinazolinone |
| 6,7-di(2'-methoxyethoxy)quinazolin-4(3H)-one |
| 6,7-BIS(2-METHOXYETHOXY)QUINAZOLIN-4-OL |
| 6,7-bis(2-methoxyethoxy)quinazolin-4-one |
| 6,7-Bis(2-methoxyethoxy)-4(1H)-quinazolinone |
| 6,7-Bis-(2-Methoxyethoxy)-4(3H)-Quinazolinone |
| T66 BVM ENJ HO2O1 IO2O1 |
| 6,7-Bis(2-methoxyethoxy)-4-hydroxyquinazoline |
| Erlotinib Intermediate V |