Introduction:Basic information about CAS 299428-04-9|2-(1-Benzylpiperidin-4-yl)-2-propanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1-Benzylpiperidin-4-yl)-2-propanol |
|---|
| CAS Number | 299428-04-9 | Molecular Weight | 233.34900 |
|---|
| Density | 1.046 | Boiling Point | 331ºC |
|---|
| Molecular Formula | C15H23NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139ºC |
|---|
Names
| Name | 2-(1-Benzyl-4-piperidinyl)-2-propanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.046 |
|---|
| Boiling Point | 331ºC |
|---|
| Molecular Formula | C15H23NO |
|---|
| Molecular Weight | 233.34900 |
|---|
| Flash Point | 139ºC |
|---|
| Exact Mass | 233.17800 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 2.60740 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | CSIDYOSFZZTUHW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(O)C1CCN(Cc2ccccc2)CC1 |
|---|
Synonyms
| 1-benzyl-2-piperidineethanol |
| N-benzyl-2-piperidineethanol |
| 2-(1-Benzylpiperidin-4-yl)-2-propanol |