Introduction:Basic information about CAS 46399-68-2|1-(5-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-N,N-dimethylmethanami ne, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(5-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-N,N-dimethylmethanami ne |
|---|
| CAS Number | 46399-68-2 | Molecular Weight | 205.25600 |
|---|
| Density | 1.168g/cm3 | Boiling Point | 323.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 149.3ºC |
|---|
Names
| Name | 1-(5-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)-N,N-dimethylmethanami ne |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.168g/cm3 |
|---|
| Boiling Point | 323.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15N3O |
|---|
| Molecular Weight | 205.25600 |
|---|
| Flash Point | 149.3ºC |
|---|
| Exact Mass | 205.12200 |
|---|
| PSA | 41.15000 |
|---|
| LogP | 1.63310 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | XPGRQQYMQLDFFX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2[nH]cc(CN(C)C)c2n1 |
|---|
Synonyms
| 3-Dimethylaminomethyl-5-methoxy-4-aza-indol |
| 5-Dimethylaminogramine |
| 3-Dimethylaminomethyl-5-dimethylaminoindol |