Introduction：Basic information about CAS 7230-50-4|N-(3-chloro-2-methylphenyl)-4-methylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-chloro-2-methylphenyl)-4-methylbenzenesulfonamide |
|---|
| CAS Number | 7230-50-4 | Molecular Weight | 825.123 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 893.7±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C52H72O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 494.3±34.3 °C |
|---|
Names
| Name | 3'-Chloro-2'-methyl-p-toluenesulfonanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 893.7±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C52H72O8 |
|---|
| Molecular Weight | 825.123 |
|---|
| Flash Point | 494.3±34.3 °C |
|---|
| Exact Mass | 824.522705 |
|---|
| PSA | 117.84000 |
|---|
| LogP | 10.84 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | KPRWHOCOWVZODI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(Cl)c2C)cc1 |
|---|
Synonyms
| Ethanol, 2,2',2'',2'''-[[5,11,17,23-tetrakis(1,1-dimethylethyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrayl]tetrakis( oxy)]tetrakis- |
| Benzenemethanol,3-bromo-,4-methylbenzenesulfonate |
| 6-Chlor-2-p-toluolsulfamino-toluol |
| m-Brom-benzyltosylat |
| 2,2',2'',2'''-{[5,11,17,23-Tetrakis(2-methyl-2-propanyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrayl]tetrakis(oxy)}te traethanol |
| N-(3-chloro-2-methylphenyl)-4-methylbenzenesulfonamide |
