Introduction：Basic information about CAS 1003043-25-1|2-(Tert-Butoxycarbonyl)Phenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Tert-Butoxycarbonyl)Phenylboronic acid |
|---|
| CAS Number | 1003043-25-1 | Molecular Weight | 222.045 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 374.3±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15BO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.2±28.4 °C |
|---|
Names
| Name | (2-{[(2-Methyl-2-propanyl)oxy]carbonyl}phenyl)boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 374.3±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15BO4 |
|---|
| Molecular Weight | 222.045 |
|---|
| Flash Point | 180.2±28.4 °C |
|---|
| Exact Mass | 222.106339 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.80 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | NGCHASOIZPPFBK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1ccccc1B(O)O |
|---|
Synonyms
| Benzoic acid, 2-borono-, 1,1-dimethylethyl ester |
| (2-{[(2-Methyl-2-propanyl)oxy]carbonyl}phenyl)boronic acid |
| 2-(Tert-Butoxycarbonyl)Phenylboronic acid |
