Introduction：Basic information about CAS 936648-34-9|tert-butyl 6-amino-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 6-amino-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|
| CAS Number | 936648-34-9 | Molecular Weight | 332.39400 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 522.823ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 269.994ºC |
|---|
Names
| Name | tert-butyl 6-amino-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 522.823ºC at 760 mmHg |
|---|
| Molecular Formula | C18H24N2O4 |
|---|
| Molecular Weight | 332.39400 |
|---|
| Flash Point | 269.994ºC |
|---|
| Exact Mass | 332.17400 |
|---|
| PSA | 81.86000 |
|---|
| LogP | 3.52280 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | KUUQLIAYCGNJFN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)c1cc(N)ccc1O2 |
|---|
