Introduction：Basic information about CAS 10029-31-9|N-isopropyl-4,4'-methylenedianiline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-isopropyl-4,4'-methylenedianiline |
|---|
| CAS Number | 10029-31-9 | Molecular Weight | 240.34300 |
|---|
| Density | 1.073g/cm3 | Boiling Point | 408.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H20N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.3ºC |
|---|
Names
| Name | 4-[[4-(propan-2-ylamino)phenyl]methyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.073g/cm3 |
|---|
| Boiling Point | 408.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H20N2 |
|---|
| Molecular Weight | 240.34300 |
|---|
| Flash Point | 237.3ºC |
|---|
| Exact Mass | 240.16300 |
|---|
| PSA | 38.05000 |
|---|
| LogP | 4.33410 |
|---|
| Vapour Pressure | 7.14E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | OYZBHMQKSAYWAI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Nc1ccc(Cc2ccc(N)cc2)cc1 |
|---|
Synonyms
| N-Isopropylmethylenedianiline |
| EINECS 233-077-6 |
| N-Isopropyl-4,4'-methylenedianiline |
| 4-(4-aminobenzyl)-n-isopropylaniline |
