Introduction：Basic information about CAS 105125-00-6|3'-Bromo-2,2':5',2''-terthiophene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3'-Bromo-2,2':5',2''-terthiophene |
|---|
| CAS Number | 105125-00-6 | Molecular Weight | 327.28300 |
|---|
| Density | 1.599g/cm3 | Boiling Point | 376.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H7BrS3 | Melting Point | 40°C |
|---|
| MSDS | / | Flash Point | 181.7ºC |
|---|
Names
| Name | 3'-Bromo-2,2':5',2''-terthiophene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.599g/cm3 |
|---|
| Boiling Point | 376.9ºC at 760mmHg |
|---|
| Melting Point | 40°C |
|---|
| Molecular Formula | C12H7BrS3 |
|---|
| Molecular Weight | 327.28300 |
|---|
| Flash Point | 181.7ºC |
|---|
| Exact Mass | 325.88900 |
|---|
| PSA | 84.72000 |
|---|
| LogP | 5.96760 |
|---|
| Vapour Pressure | 1.53E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | FGBHDLKMGUOJBA-UHFFFAOYSA-N |
|---|
| SMILES | Brc1cc(-c2cccs2)sc1-c1cccs1 |
|---|
Synonyms
| 3-Bromo-2,5-di(2-thienyl)thiophene |
| 3-bromo-2,5-dithiophen-2-ylthiophene |
