Introduction：Basic information about CAS 14309-25-2|Tritylazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tritylazide |
|---|
| CAS Number | 14309-25-2 | Molecular Weight | 285.342 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H15N3 | Melting Point | 61-62ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Trityl Azide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 61-62ºC |
|---|
| Molecular Formula | C19H15N3 |
|---|
| Molecular Weight | 285.342 |
|---|
| Exact Mass | 285.126587 |
|---|
| PSA | 49.75000 |
|---|
| LogP | 6.72 |
|---|
| InChIKey | OZHQKHFCDZKWFC-UHFFFAOYSA-N |
|---|
| SMILES | [N-]=[N+]=NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Risk Phrases | 2-11 |
|---|
| Safety Phrases | 15-17-33 |
|---|
| RIDADR | UN 1325 |
|---|
| HS Code | 2929909090 |
|---|
Customs
| HS Code | 2929909090 |
|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Tritylazide |
| Benzene, 1,1',1''-(azidomethylidyne)tris- |
| Methane, azidotriphenyl- |
| 1,1',1''-(Azidomethanetriyl)tribenzene |
| Benzene, 1,1',1''- (azidomethylidyne)tris- |
| Trityl Azide |
| Triphenylmethyl Azide |
| [azido(diphenyl)methyl]benzene |
