Introduction：Basic information about CAS 4441-01-4|1,2,4-triphenylbutane-1,4-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2,4-triphenylbutane-1,4-dione |
|---|
| CAS Number | 4441-01-4 | Molecular Weight | 314.37700 |
|---|
| Density | 1.143g/cm3 | Boiling Point | 496.2ºC at 760 mmHg |
|---|
| Molecular Formula | C22H18O2 | Melting Point | 126-127ºC |
|---|
| MSDS | / | Flash Point | 183.6ºC |
|---|
Names
| Name | 1,2,4-triphenylbutane-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.143g/cm3 |
|---|
| Boiling Point | 496.2ºC at 760 mmHg |
|---|
| Melting Point | 126-127ºC |
|---|
| Molecular Formula | C22H18O2 |
|---|
| Molecular Weight | 314.37700 |
|---|
| Flash Point | 183.6ºC |
|---|
| Exact Mass | 314.13100 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.92610 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | UDJIUKWJBHQMBG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 1.4-Dioxo-1.2.4-triphenyl-butan |
| MFCD00043773 |
| 1,4-Butanedione,1,2,4-triphenyl |
| 1,2,4-Triphenyl-1,4-butanedione |
| 1,2,4-triphenyl-1,4-dione |
| 1,2,4-triphenyl-1,4-butandione |
| 1,2,4-triphenyl-butane-1,4-dione |
| 1,2,4-Triphenyl-butan-1,4-dion |
