Introduction：Basic information about CAS 815-82-7|(±)-Tartaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (±)-Tartaric acid |
|---|
| CAS Number | 815-82-7 | Molecular Weight | 150.087 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 399.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H4CuO6 | Melting Point | ~275 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 209.4±24.4 °C |
|---|
Names
| Name | Copper(II) (2R,3R)-2,3-dihydroxysuccinate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 399.3±42.0 °C at 760 mmHg |
|---|
| Melting Point | ~275 °C (dec.)(lit.) |
|---|
| Molecular Formula | C4H4CuO6 |
|---|
| Molecular Weight | 150.087 |
|---|
| Flash Point | 209.4±24.4 °C |
|---|
| Exact Mass | 150.016434 |
|---|
| PSA | 120.72000 |
|---|
| LogP | -1.43 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | XIPWCAOMSIUHSL-ZVGUSBNCSA-N |
|---|
| SMILES | O=C(O)C(O)C(O)C(=O)O.[Cu] |
|---|
| Water Solubility | slightly soluble |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| RIDADR | UN 9111 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| DL-Tartaric acid |
| copper,(2R,3R)-2,3-dihydroxybutanedioate |
| 2,3-Dihydroxy-succinic acid |
| 2,3-dihydroxysuccinic acid |
| Tartaric acid, (±)- |
| 2,3-dihydroxybutanedioic acid |
| Butanedioic acid, 2,3-dihydroxy- |
| Tartaric acid |
| Tartaric acid, (DL)- |
| EINECS 212-425-0 |
| MFCD00150650 |
