Introduction：Basic information about CAS 4141-48-4|allyldiphenylphosphine oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | allyldiphenylphosphine oxide |
|---|
| CAS Number | 4141-48-4 | Molecular Weight | 242.25300 |
|---|
| Density | 1.09g/cm3 | Boiling Point | 337ºC at 760mmHg |
|---|
| Molecular Formula | C15H15OP | Melting Point | 110-114ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 157.6ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | [phenyl(prop-2-enyl)phosphoryl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.09g/cm3 |
|---|
| Boiling Point | 337ºC at 760mmHg |
|---|
| Melting Point | 110-114ºC(lit.) |
|---|
| Molecular Formula | C15H15OP |
|---|
| Molecular Weight | 242.25300 |
|---|
| Flash Point | 157.6ºC |
|---|
| Exact Mass | 242.08600 |
|---|
| PSA | 26.88000 |
|---|
| LogP | 3.18650 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | PGPAPANRSWMTQO-UHFFFAOYSA-N |
|---|
| SMILES | C=CCP(=O)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| Allyldiphenylphosphine oxide |
| allyldiphenylphosphane oxide |
| diphenyl allyl phosphine oxide |
| MFCD00013908 |
