Introduction：Basic information about CAS 886230-77-9|(E)-6-Iodo-3-[2-(pyridin-2-yl)ethenyl]-1-(tetrahydro-2H-pyran-2-yl)-1H-indazo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-6-Iodo-3-[2-(pyridin-2-yl)ethenyl]-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole |
|---|
| CAS Number | 886230-77-9 | Molecular Weight | 431.270 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 561.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H18IN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.2±30.1 °C |
|---|
Names
| Name | 6-iodo-1-(oxan-2-yl)-3-(2-pyridin-2-ylethenyl)indazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 561.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H18IN3O |
|---|
| Molecular Weight | 431.270 |
|---|
| Flash Point | 293.2±30.1 °C |
|---|
| Exact Mass | 431.049438 |
|---|
| PSA | 39.94000 |
|---|
| LogP | 4.33 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | QXJFRDDGGSSQDX-CSKARUKUSA-N |
|---|
| SMILES | Ic1ccc2c(C=Cc3ccccn3)nn(C3CCCCO3)c2c1 |
|---|
Synonyms
| 6-iodo-1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole |
| 1H-Indazole, 6-iodo-3-[(E)-2-(2-pyridinyl)ethenyl]-1-(tetrahydro-2H-pyran-2-yl)- |
| (E)-6-IODO-3-[2-(PYRIDIN-2-YL)ETHENYL]-1-(TETRAHYDRO-2H-PYRAN-2-YL)-1H-INDAZOLE |
| 6-Iodo-3-[(E)-2-(2-pyridinyl)vinyl]-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole |
