Introduction：Basic information about CAS 376591-95-6|2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid |
|---|
| CAS Number | 376591-95-6 | Molecular Weight | 259.214 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 452.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.8±15.8 °C |
|---|
Names
| Name | 2-Hydroxy-3-nitrobiphenyl-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 452.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9NO5 |
|---|
| Molecular Weight | 259.214 |
|---|
| Flash Point | 193.8±15.8 °C |
|---|
| Exact Mass | 259.048065 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 2.83 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | JCFPSTQCDAZKJN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(-c2cccc([N+](=O)[O-])c2O)c1 |
|---|
Synonyms
| 2'-Hydroxy-3'-nitrobiphenyl-3-carboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid,2'-hydroxy-3'-nitro |
| 2-Hydroxy-3-nitrobiphenyl-3-carboxylic acid |
| 2'-Hydroxy-3'-nitro-3-biphenylcarboxylic acid |
| 3-(2-hydroxy-3-nitrophenyl)benzoic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 2'-hydroxy-3'-nitro- |
| 2'-Hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid |
| Eltrombopag olamine Intermediate 2 |
