Introduction：Basic information about CAS 376592-58-4|5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5'-chloro-2'-hydroxy-3'-nitro-[1,1'-Biphenyl]-3-carboxylic acid |
|---|
| CAS Number | 376592-58-4 | Molecular Weight | 293.659 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 467.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.5±28.7 °C |
|---|
Names
| Name | 3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 467.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO5 |
|---|
| Molecular Weight | 293.659 |
|---|
| Flash Point | 236.5±28.7 °C |
|---|
| Exact Mass | 293.009094 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 3.84 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | PGNTVCRTPYDGRN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c1 |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 5'-Chloro-2'-hydroxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 5'-chloro-2'-hydroxy-3'-nitro- |
| 5'-chloro-2'-hydroxy-3'-nitrobiphenyl-3-carboxylic acid |
| 5'-Chloro-2'-hydroxy-3'-nitro-3-biphenylcarboxylic acid |
