Introduction：Basic information about CAS 561-79-5|Metcaraphen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Metcaraphen |
|---|
| CAS Number | 561-79-5 | Molecular Weight | 317.46600 |
|---|
| Density | 1.019g/cm3 | Boiling Point | 424.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H31NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 128ºC |
|---|
Names
| Name | 2-(diethylamino)ethyl 1-(3,4-dimethylphenyl)cyclopentane-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.019g/cm3 |
|---|
| Boiling Point | 424.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H31NO2 |
|---|
| Molecular Weight | 317.46600 |
|---|
| Flash Point | 128ºC |
|---|
| Exact Mass | 317.23500 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 4.00020 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | PZXHGLCYRMTHNF-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOC(=O)C1(c2ccc(C)c(C)c2)CCCC1 |
|---|
Synonyms
| Dimethylcaraminophen |
| UNII-00LX015OW8 |
| G 3012 |
| Metcaraphen |
