Introduction:Basic information about CAS 62199-60-4|4-Nitro-2'-carboxybiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitro-2'-carboxybiphenyl |
|---|
| CAS Number | 62199-60-4 | Molecular Weight | 243.21500 |
|---|
| Density | 1.358g/cm3 | Boiling Point | 407.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.4ºC |
|---|
Names
| Name | 5-nitro-2-phenylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.358g/cm3 |
|---|
| Boiling Point | 407.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9NO4 |
|---|
| Molecular Weight | 243.21500 |
|---|
| Flash Point | 174.4ºC |
|---|
| Exact Mass | 243.05300 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.48320 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | FNHCGDVQGIEGRQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1-c1ccccc1 |
|---|
Synonyms
| 4-nitrobiphenyl-2-carboxylic acid |
| 4-Nitro-2-biphenylcarboxylic acid |
| 4-Nitrobiphenyl-carbonsaeure-(2) |
| 2-phenyl-4-nitrobenzoic acid |
| (1,1'-Biphenyl)-2-carboxylic acid,4-nitro |
| 4-Nitro-(1,1'-biphenyl)-2-carboxylic acid |
| 4-Nitro-biphenyl-2-carbonsaeure |
| 2-phenyl-5-nitrobenzoic acid |