Introduction:Basic information about CAS 10273-74-2|p-xylylenebis(triphenylphosphonium bromide), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-xylylenebis(triphenylphosphonium bromide) |
|---|
| CAS Number | 10273-74-2 | Molecular Weight | 788.52800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C44H38Br2P2 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | triphenyl-[[3-(triphenylphosphaniumylmethyl)phenyl]methyl]phosphanium |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C44H38Br2P2 |
|---|
| Molecular Weight | 788.52800 |
|---|
| Exact Mass | 786.08200 |
|---|
| PSA | 27.18000 |
|---|
| LogP | 2.68280 |
|---|
| Appearance of Characters | liquid |
|---|
| InChIKey | CHEKMRAXUMTCIO-UHFFFAOYSA-M |
|---|
| SMILES | [Br-].c1ccc([P+](Cc2cccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c2)(c2ccccc2)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| WGK Germany | 3 |
|---|