Introduction：Basic information about CAS 27306-78-1|dimethylsiloxane, ethylene oxide block copolymer, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethylsiloxane, ethylene oxide block copolymer |
|---|
| CAS Number | 27306-78-1 | Molecular Weight | 338.66300 |
|---|
| Density | 1.035 g/cm3 | Boiling Point | 200 13mm |
|---|
| Molecular Formula | C13H34O4Si3 | Melting Point | #NAME? |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | 3-(2-methoxyethoxy)propyl-methyl-bis(trimethylsilyloxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.035 g/cm3 |
|---|
| Boiling Point | 200 13mm |
|---|
| Melting Point | #NAME? |
|---|
| Molecular Formula | C13H34O4Si3 |
|---|
| Molecular Weight | 338.66300 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 338.17600 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 3.81450 |
|---|
| Index of Refraction | n20/D 1.455 |
|---|
| InChIKey | JQRXTVACLHSVTF-UHFFFAOYSA-N |
|---|
| SMILES | COCCOCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | UN 2987 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2942000000 |
|---|
Customs
Synonyms
| Polyethylene glycol mono(3-(tetramethyl-1-(trimethylsiloxy)disiloxanyl)propyl)ether |
| Silwet L 77 |
| MFCD00240065 |
