Introduction:Basic information about CAS 52591-27-2|1H,1H,2H,2H-Nonafluorohexyl Acrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H,2H,2H-Nonafluorohexyl Acrylate |
|---|
| CAS Number | 52591-27-2 | Molecular Weight | 318.13600 |
|---|
| Density | 1.414 | Boiling Point | 164ºC |
|---|
| Molecular Formula | C9H7F9O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 52ºC |
|---|
Names
| Name | 2-(Perfluorobutyl)ethyl acrylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.414 |
|---|
| Boiling Point | 164ºC |
|---|
| Molecular Formula | C9H7F9O2 |
|---|
| Molecular Weight | 318.13600 |
|---|
| Flash Point | 52ºC |
|---|
| Exact Mass | 318.03000 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.57390 |
|---|
| Index of Refraction | 1.31 |
|---|
| InChIKey | GYUPEJSTJSFVRR-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2916129000 |
|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Acrylic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester |
| Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester |
| Acrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester |
| 1H,1H,2H,2H-Nonafluorohexyl Acrylate |
| 2-Propenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester |
| 1H,1H,2H,2H-Perfluorohexyl acrylate |
| 1H,1H,2H,2H-Nonafluorohexyl acrylate |
| 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Acrylate |
| DAIKIN R-1420 |
| C4F9CH2CH2OCOCH=CH2 |
| 3,3,4,4,5,5,6,6,6-Nonafluorohexylacrylate |