Introduction:Basic information about CAS 324063-66-3|oxo-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | oxo-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin |
|---|
| CAS Number | 324063-66-3 | Molecular Weight | 828.89400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H8F26OSn | Melting Point | 92-94ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | oxo-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 92-94ºC |
|---|
| Molecular Formula | C16H8F26OSn |
|---|
| Molecular Weight | 828.89400 |
|---|
| Exact Mass | 829.91800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 9.66620 |
|---|
| InChIKey | VCPJPAQHWCNPKF-UHFFFAOYSA-N |
|---|
| SMILES | O=[Sn](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R53;R36/37/38 |
|---|
| Safety Phrases | S61 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Stannane,oxobis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) |
| MFCD03788366 |
| Bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin oxide |
| Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide |